C8H12F3N3O3S2 — CID 63946016
2-amino-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-sulfonamide (PubChem CID 63946016) has the molecular formula C8H12F3N3O3S2 and a molecular weight of 319.33 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63946016 |
| Molecular Formula | C8H12F3N3O3S2 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 2-amino-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)NCCOCC(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O3S2/c1-5-6(18-7(12)14-5)19(15,16)13-2-3-17-4-8(9,10)11/h13H,2-4H2,1H3,(H2,12,14) |
| InChIKey | DUGBESSNVNNVAL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|