About 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride
4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride (PubChem CID 63946632) has the molecular formula C7H11ClN2O4S3
and a molecular weight of 318.83 g/mol. Its IUPAC name is 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride |
| PubChem CID | 63946632 |
| Molecular Formula | C7H11ClN2O4S3 |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride |
| SMILES | Cc1nc(NS(=O)(=O)C(C)C)sc1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H11ClN2O4S3/c1-4(2)17(13,14)10-7-9-5(3)6(15-7)16(8,11)12/h4H,1-3H3,(H,9,10) |
| InChIKey | XMIPAVNIUJMLIV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride?
The IUPAC name of 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride (CID 63946632) is 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride.
What is the SMILES notation for 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride?
The canonical SMILES for 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride is Cc1nc(NS(=O)(=O)C(C)C)sc1S(=O)(=O)Cl.
What is the InChIKey of 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride?
The InChIKey is XMIPAVNIUJMLIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2O4S3/c1-4(2)17(13,14)10-7-9-5(3)6(15-7)16(8,11)12/h4H,1-3H3,(H,9,10).
What are the key properties of 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride?
4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride has a molecular weight of 318.83 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(propan-2-ylsulfonylamino)-1,3-thiazole-5-sulfonyl chloride is sourced from PubChem (CID 63946632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).