C11H18N4O2S2 — CID 63947223
2-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-4-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 63947223) has the molecular formula C11H18N4O2S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 2-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-4-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-4-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63947223 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-amino-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-4-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(N)sc1S(=O)(=O)NC1CCN2CCCC12 |
| InChI | InChI=1S/C11H18N4O2S2/c1-7-10(18-11(12)13-7)19(16,17)14-8-4-6-15-5-2-3-9(8)15/h8-9,14H,2-6H2,1H3,(H2,12,13) |
| InChIKey | TYYYYVMWNVMQKL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |