C17H24N2 — CID 63948446
1-isoquinolin-1-yl-N,3-dimethylhexan-1-amine (PubChem CID 63948446) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-isoquinolin-1-yl-N,3-dimethylhexan-1-amine.
| Compound Name | 1-isoquinolin-1-yl-N,3-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 63948446 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-isoquinolin-1-yl-N,3-dimethylhexan-1-amine |
| SMILES | CCCC(C)CC(NC)c1nccc2ccccc12 |
| InChI | InChI=1S/C17H24N2/c1-4-7-13(2)12-16(18-3)17-15-9-6-5-8-14(15)10-11-19-17/h5-6,8-11,13,16,18H,4,7,12H2,1-3H3 |
| InChIKey | VYJVPJHGDXHHPA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |