About N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine
N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine (PubChem CID 63949144) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine |
| PubChem CID | 63949144 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine |
| SMILES | COc1cc(CNC2CC2)c(-c2ccoc2)cc1OC |
| InChI | InChI=1S/C16H19NO3/c1-18-15-7-12(9-17-13-3-4-13)14(8-16(15)19-2)11-5-6-20-10-11/h5-8,10,13,17H,3-4,9H2,1-2H3 |
| InChIKey | BGNYHJBDOVXYGU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine?
The IUPAC name of N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine (CID 63949144) is N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine?
The canonical SMILES for N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine is COc1cc(CNC2CC2)c(-c2ccoc2)cc1OC.
What is the InChIKey of N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine?
The InChIKey is BGNYHJBDOVXYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-18-15-7-12(9-17-13-3-4-13)14(8-16(15)19-2)11-5-6-20-10-11/h5-8,10,13,17H,3-4,9H2,1-2H3.
What are the key properties of N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine?
N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine has a molecular weight of 273.33 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(furan-3-yl)-4,5-dimethoxyphenyl]methyl]cyclopropanamine is sourced from PubChem (CID 63949144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).