About CID 6394929
CID 6394929 (PubChem CID 6394929) has the molecular formula C48H52GaO
and a molecular weight of 714.67 g/mol.
Molecular Properties
| Compound Name | CID 6394929 |
| PubChem CID | 6394929 |
| Molecular Formula | C48H52GaO |
| Molecular Weight | 714.67 g/mol |
| Exact Mass | 713.33 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[Ga]c2c(-c3c(C)cc(C)cc3C)cccc2-c2c(C)cc(C)cc2C)c(C)c1.O |
| InChI | InChI=1S/2C24H25.Ga.H2O/c2*1-15-10-17(3)23(18(4)11-15)21-8-7-9-22(14-21)24-19(5)12-16(2)13-20(24)6;;/h2*7-13H,1-6H3;;1H2 |
| InChIKey | ZFLZMFAEOLXJOR-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 714.67 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 6394929 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6394929?
The IUPAC name of CID 6394929 (CID 6394929) is not available.
What is the SMILES notation for CID 6394929?
The canonical SMILES for CID 6394929 is Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2[Ga]c2c(-c3c(C)cc(C)cc3C)cccc2-c2c(C)cc(C)cc2C)c(C)c1.O.
What is the InChIKey of CID 6394929?
The InChIKey is ZFLZMFAEOLXJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C24H25.Ga.H2O/c2*1-15-10-17(3)23(18(4)11-15)21-8-7-9-22(14-21)24-19(5)12-16(2)13-20(24)6;;/h2*7-13H,1-6H3;;1H2.
What are the key properties of CID 6394929?
CID 6394929 has a molecular weight of 714.67 g/mol, XLogP of 10.89, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6394929 is sourced from PubChem (CID 6394929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).