C15H22ClNO3 — CID 63949713
methyl 3-[4-[(tert-butylamino)methyl]-2-chlorophenoxy]propanoate (PubChem CID 63949713) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is methyl 3-[4-[(tert-butylamino)methyl]-2-chlorophenoxy]propanoate.
| Compound Name | methyl 3-[4-[(tert-butylamino)methyl]-2-chlorophenoxy]propanoate |
|---|---|
| PubChem CID | 63949713 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 3-[4-[(tert-butylamino)methyl]-2-chlorophenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(CNC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C15H22ClNO3/c1-15(2,3)17-10-11-5-6-13(12(16)9-11)20-8-7-14(18)19-4/h5-6,9,17H,7-8,10H2,1-4H3 |
| InChIKey | MANJFNVYPNHEPU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |