C14H30N8O4 — CID 6395061
1,8-dinitro-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosane (PubChem CID 6395061) has the molecular formula C14H30N8O4 and a molecular weight of 374.45 g/mol. Its IUPAC name is 1,8-dinitro-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosane.
| Compound Name | 1,8-dinitro-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosane |
|---|---|
| PubChem CID | 6395061 |
| Molecular Formula | C14H30N8O4 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1,8-dinitro-3,6,10,13,16,19-hexazabicyclo[6.6.6]icosane |
| SMILES | O=[N+]([O-])C12CNCCNCC([N+](=O)[O-])(CNCCNC1)CNCCNC2 |
| InChI | InChI=1S/C14H30N8O4/c23-21(24)13-7-15-1-2-16-8-14(22(25)26,11-19-5-3-17-9-13)12-20-6-4-18-10-13/h15-20H,1-12H2 |
| InChIKey | UBBAQMVTJTUDEU-UHFFFAOYSA-N |
| XLogP | -3.42 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|