C12H19NO6 — CID 63951112
2-[carboxymethyl-[3-(oxan-2-yl)propanoyl]amino]acetic acid (PubChem CID 63951112) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-[carboxymethyl-[3-(oxan-2-yl)propanoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[3-(oxan-2-yl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 63951112 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-[carboxymethyl-[3-(oxan-2-yl)propanoyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)CCC1CCCCO1 |
| InChI | InChI=1S/C12H19NO6/c14-10(5-4-9-3-1-2-6-19-9)13(7-11(15)16)8-12(17)18/h9H,1-8H2,(H,15,16)(H,17,18) |
| InChIKey | SMNPIRKWUAMIRB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |