C16H22N2O2 — CID 63952299
1-(5-amino-2,3-dihydroindol-1-yl)-3-(oxan-2-yl)propan-1-one (PubChem CID 63952299) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(5-amino-2,3-dihydroindol-1-yl)-3-(oxan-2-yl)propan-1-one.
| Compound Name | 1-(5-amino-2,3-dihydroindol-1-yl)-3-(oxan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 63952299 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(5-amino-2,3-dihydroindol-1-yl)-3-(oxan-2-yl)propan-1-one |
| SMILES | Nc1ccc2c(c1)CCN2C(=O)CCC1CCCCO1 |
| InChI | InChI=1S/C16H22N2O2/c17-13-4-6-15-12(11-13)8-9-18(15)16(19)7-5-14-3-1-2-10-20-14/h4,6,11,14H,1-3,5,7-10,17H2 |
| InChIKey | MZGSGVSHORDFNC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|