C16H30N2OS — CID 63953260
N-(2-methoxyethyl)-3-(4-propan-2-yl-1,3-thiazol-2-yl)heptan-3-amine (PubChem CID 63953260) has the molecular formula C16H30N2OS and a molecular weight of 298.50 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(4-propan-2-yl-1,3-thiazol-2-yl)heptan-3-amine.
| Compound Name | N-(2-methoxyethyl)-3-(4-propan-2-yl-1,3-thiazol-2-yl)heptan-3-amine |
|---|---|
| PubChem CID | 63953260 |
| Molecular Formula | C16H30N2OS |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | N-(2-methoxyethyl)-3-(4-propan-2-yl-1,3-thiazol-2-yl)heptan-3-amine |
| SMILES | CCCCC(CC)(NCCOC)c1nc(C(C)C)cs1 |
| InChI | InChI=1S/C16H30N2OS/c1-6-8-9-16(7-2,17-10-11-19-5)15-18-14(12-20-15)13(3)4/h12-13,17H,6-11H2,1-5H3 |
| InChIKey | NFRPSZQLFUIMCU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|