C15H20N2O4 — CID 63953505
N-(6-amino-1,3-benzodioxol-5-yl)-3-(oxan-2-yl)propanamide (PubChem CID 63953505) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is N-(6-amino-1,3-benzodioxol-5-yl)-3-(oxan-2-yl)propanamide.
| Compound Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(oxan-2-yl)propanamide |
|---|---|
| PubChem CID | 63953505 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-(6-amino-1,3-benzodioxol-5-yl)-3-(oxan-2-yl)propanamide |
| SMILES | Nc1cc2c(cc1NC(=O)CCC1CCCCO1)OCO2 |
| InChI | InChI=1S/C15H20N2O4/c16-11-7-13-14(21-9-20-13)8-12(11)17-15(18)5-4-10-3-1-2-6-19-10/h7-8,10H,1-6,9,16H2,(H,17,18) |
| InChIKey | KBGXMALTEVUAPL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|