C17H26F2N2 — CID 63954399
N-(cyclopropylmethyl)-N-ethyl-2,6-difluoro-4-[(2-methylpropylamino)methyl]aniline (PubChem CID 63954399) has the molecular formula C17H26F2N2 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-ethyl-2,6-difluoro-4-[(2-methylpropylamino)methyl]aniline.
| Compound Name | N-(cyclopropylmethyl)-N-ethyl-2,6-difluoro-4-[(2-methylpropylamino)methyl]aniline |
|---|---|
| PubChem CID | 63954399 |
| Molecular Formula | C17H26F2N2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-(cyclopropylmethyl)-N-ethyl-2,6-difluoro-4-[(2-methylpropylamino)methyl]aniline |
| SMILES | CCN(CC1CC1)c1c(F)cc(CNCC(C)C)cc1F |
| InChI | InChI=1S/C17H26F2N2/c1-4-21(11-13-5-6-13)17-15(18)7-14(8-16(17)19)10-20-9-12(2)3/h7-8,12-13,20H,4-6,9-11H2,1-3H3 |
| InChIKey | WADZOEGRWUCXNR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|