C14H27N3 — CID 63955060
4-[cyclopropylmethyl(ethyl)amino]-2-methyl-2-(propylamino)butanenitrile (PubChem CID 63955060) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 4-[cyclopropylmethyl(ethyl)amino]-2-methyl-2-(propylamino)butanenitrile.
| Compound Name | 4-[cyclopropylmethyl(ethyl)amino]-2-methyl-2-(propylamino)butanenitrile |
|---|---|
| PubChem CID | 63955060 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 4-[cyclopropylmethyl(ethyl)amino]-2-methyl-2-(propylamino)butanenitrile |
| SMILES | CCCNC(C)(C#N)CCN(CC)CC1CC1 |
| InChI | InChI=1S/C14H27N3/c1-4-9-16-14(3,12-15)8-10-17(5-2)11-13-6-7-13/h13,16H,4-11H2,1-3H3 |
| InChIKey | XTLDGEJFNBWKAL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |