C12H28N4 — CID 6395752
5,12-dimethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 6395752) has the molecular formula C12H28N4 and a molecular weight of 228.38 g/mol. Its IUPAC name is 5,12-dimethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 5,12-dimethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 6395752 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 5,12-dimethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CC1CCNCCNC(C)CCNCCN1 |
| InChI | InChI=1S/C12H28N4/c1-11-3-5-13-8-10-16-12(2)4-6-14-7-9-15-11/h11-16H,3-10H2,1-2H3 |
| InChIKey | ZATMZFRYHBHNEA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |