C11H22N2O3S — CID 63957961
2-[(2-methyl-3-methylsulfanylpropyl)carbamoylamino]pentanoic acid (PubChem CID 63957961) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2-[(2-methyl-3-methylsulfanylpropyl)carbamoylamino]pentanoic acid.
| Compound Name | 2-[(2-methyl-3-methylsulfanylpropyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 63957961 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[(2-methyl-3-methylsulfanylpropyl)carbamoylamino]pentanoic acid |
| SMILES | CCCC(NC(=O)NCC(C)CSC)C(=O)O |
| InChI | InChI=1S/C11H22N2O3S/c1-4-5-9(10(14)15)13-11(16)12-6-8(2)7-17-3/h8-9H,4-7H2,1-3H3,(H,14,15)(H2,12,13,16) |
| InChIKey | SECPKXANTWAOOV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |