About 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione
1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione (PubChem CID 63958046) has the molecular formula C8H12N2O3S
and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione.
Molecular Properties
| Compound Name | 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione |
| PubChem CID | 63958046 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione |
| SMILES | CSCC(C)CN1C(=O)NC(=O)C1=O |
| InChI | InChI=1S/C8H12N2O3S/c1-5(4-14-2)3-10-7(12)6(11)9-8(10)13/h5H,3-4H2,1-2H3,(H,9,11,13) |
| InChIKey | BIVYLKUSHFRNJN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione?
The IUPAC name of 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione (CID 63958046) is 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione.
What is the SMILES notation for 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione?
The canonical SMILES for 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione is CSCC(C)CN1C(=O)NC(=O)C1=O.
What is the InChIKey of 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione?
The InChIKey is BIVYLKUSHFRNJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3S/c1-5(4-14-2)3-10-7(12)6(11)9-8(10)13/h5H,3-4H2,1-2H3,(H,9,11,13).
What are the key properties of 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione?
1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione has a molecular weight of 216.26 g/mol, XLogP of 0.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-3-methylsulfanylpropyl)imidazolidine-2,4,5-trione is sourced from PubChem (CID 63958046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).