About 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline
3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline (PubChem CID 639582) has the molecular formula C15H15ClN2
and a molecular weight of 258.75 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline.
Molecular Properties
| Compound Name | 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline |
| PubChem CID | 639582 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline |
| SMILES | Clc1ccc(CN2CNc3ccccc3C2)cc1 |
| InChI | InChI=1S/C15H15ClN2/c16-14-7-5-12(6-8-14)9-18-10-13-3-1-2-4-15(13)17-11-18/h1-8,17H,9-11H2 |
| InChIKey | PGCVGSJEUINKJH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline?
The IUPAC name of 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline (CID 639582) is 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline.
What is the SMILES notation for 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline?
The canonical SMILES for 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline is Clc1ccc(CN2CNc3ccccc3C2)cc1.
What is the InChIKey of 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline?
The InChIKey is PGCVGSJEUINKJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2/c16-14-7-5-12(6-8-14)9-18-10-13-3-1-2-4-15(13)17-11-18/h1-8,17H,9-11H2.
What are the key properties of 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline?
3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline has a molecular weight of 258.75 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chlorophenyl)methyl]-2,4-dihydro-1H-quinazoline is sourced from PubChem (CID 639582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).