C16H26N2O2S — CID 63958323
4-[(cyclopropylamino)methyl]-N-methyl-N-(2-methylbutan-2-yl)benzenesulfonamide (PubChem CID 63958323) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 4-[(cyclopropylamino)methyl]-N-methyl-N-(2-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-[(cyclopropylamino)methyl]-N-methyl-N-(2-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 63958323 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-[(cyclopropylamino)methyl]-N-methyl-N-(2-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)(C)N(C)S(=O)(=O)c1ccc(CNC2CC2)cc1 |
| InChI | InChI=1S/C16H26N2O2S/c1-5-16(2,3)18(4)21(19,20)15-10-6-13(7-11-15)12-17-14-8-9-14/h6-7,10-11,14,17H,5,8-9,12H2,1-4H3 |
| InChIKey | MFZLHYWBAUAXEL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |