C12H23N3O3S — CID 63959422
2-[4-(3-methylsulfanylpropylcarbamoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 63959422) has the molecular formula C12H23N3O3S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[4-(3-methylsulfanylpropylcarbamoyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(3-methylsulfanylpropylcarbamoyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 63959422 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 2-[4-(3-methylsulfanylpropylcarbamoyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | CSCCCNC(=O)N1CCCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H23N3O3S/c1-19-9-2-4-13-12(18)15-6-3-5-14(7-8-15)10-11(16)17/h2-10H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | NCSFQGPOPRVGHP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|