About 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide
1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide (PubChem CID 6396044) has the molecular formula C19H25N2P
and a molecular weight of 312.40 g/mol. Its IUPAC name is 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide.
Molecular Properties
| Compound Name | 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide |
| PubChem CID | 6396044 |
| Molecular Formula | C19H25N2P |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide |
| SMILES | CC(C)/N=C(\NC(C)C)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25N2P/c1-15(2)20-19(21-16(3)4)22(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16H,1-4H3,(H,20,21) |
| InChIKey | UPDPRDMMRWPXME-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide?
The IUPAC name of 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide (CID 6396044) is 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide.
What is the SMILES notation for 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide?
The canonical SMILES for 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide is CC(C)/N=C(\NC(C)C)P(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide?
The InChIKey is UPDPRDMMRWPXME-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N2P/c1-15(2)20-19(21-16(3)4)22(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-16H,1-4H3,(H,20,21).
What are the key properties of 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide?
1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide has a molecular weight of 312.40 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diphenylphosphanyl-N,N'-di(propan-2-yl)methanimidamide is sourced from PubChem (CID 6396044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).