C12H20N2S — CID 63960650
1-(3-methylsulfanylpropyl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 63960650) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 1-(3-methylsulfanylpropyl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-(3-methylsulfanylpropyl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 63960650 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-(3-methylsulfanylpropyl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | CSCCCn1ccc2c1CCCC2N |
| InChI | InChI=1S/C12H20N2S/c1-15-9-3-7-14-8-6-10-11(13)4-2-5-12(10)14/h6,8,11H,2-5,7,9,13H2,1H3 |
| InChIKey | HKPIZHKSZFRCGU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|