C14H20N2O — CID 63961549
8-(2-methylpyrazol-3-yl)tricyclo[5.2.1.02,6]decan-8-ol (PubChem CID 63961549) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 8-(2-methylpyrazol-3-yl)tricyclo[5.2.1.02,6]decan-8-ol.
| Compound Name | 8-(2-methylpyrazol-3-yl)tricyclo[5.2.1.02,6]decan-8-ol |
|---|---|
| PubChem CID | 63961549 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 8-(2-methylpyrazol-3-yl)tricyclo[5.2.1.02,6]decan-8-ol |
| SMILES | Cn1nccc1C1(O)CC2CC1C1CCCC21 |
| InChI | InChI=1S/C14H20N2O/c1-16-13(5-6-15-16)14(17)8-9-7-12(14)11-4-2-3-10(9)11/h5-6,9-12,17H,2-4,7-8H2,1H3 |
| InChIKey | CTJZOSXQRUXQOY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |