C13H12BrNO — CID 63961920
2-bromo-6-(2,3-dimethylphenoxy)pyridine (PubChem CID 63961920) has the molecular formula C13H12BrNO and a molecular weight of 278.15 g/mol. Its IUPAC name is 2-bromo-6-(2,3-dimethylphenoxy)pyridine.
| Compound Name | 2-bromo-6-(2,3-dimethylphenoxy)pyridine |
|---|---|
| PubChem CID | 63961920 |
| Molecular Formula | C13H12BrNO |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 2-bromo-6-(2,3-dimethylphenoxy)pyridine |
| SMILES | Cc1cccc(Oc2cccc(Br)n2)c1C |
| InChI | InChI=1S/C13H12BrNO/c1-9-5-3-6-11(10(9)2)16-13-8-4-7-12(14)15-13/h3-8H,1-2H3 |
| InChIKey | ISFQJEKCGMDXRM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|