C9H13N3OS — CID 63962299
4-amino-N-(2-methylsulfanylethyl)pyridine-2-carboxamide (PubChem CID 63962299) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-amino-N-(2-methylsulfanylethyl)pyridine-2-carboxamide.
| Compound Name | 4-amino-N-(2-methylsulfanylethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63962299 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-amino-N-(2-methylsulfanylethyl)pyridine-2-carboxamide |
| SMILES | CSCCNC(=O)c1cc(N)ccn1 |
| InChI | InChI=1S/C9H13N3OS/c1-14-5-4-12-9(13)8-6-7(10)2-3-11-8/h2-3,6H,4-5H2,1H3,(H2,10,11)(H,12,13) |
| InChIKey | PGVFKWJAZMFJEU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|