C16H32CuN4+2 — CID 6396234
copper 5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradeca-7,14-diene (PubChem CID 6396234) has the molecular formula C16H32CuN4+2 and a molecular weight of 344.01 g/mol. Its IUPAC name is copper 5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradeca-7,14-diene.
| Compound Name | copper 5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradeca-7,14-diene |
|---|---|
| PubChem CID | 6396234 |
| Molecular Formula | C16H32CuN4+2 |
| Molecular Weight | 344.01 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | copper 5,5,7,12,12,14-hexamethyl-1,4,8,11-tetrazacyclotetradeca-7,14-diene |
| SMILES | C/C1=N\CCNC(C)(C)C/C(C)=N/CCNC(C)(C)C1.[Cu+2] |
| InChI | InChI=1S/C16H32N4.Cu/c1-13-11-15(3,4)19-10-8-18-14(2)12-16(5,6)20-9-7-17-13;/h19-20H,7-12H2,1-6H3;/q;+2/b17-13+,18-14+; |
| InChIKey | UPFQLNMIMPRFNS-GPSHETCQSA-N |
| XLogP | 2.44 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.01 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |