C22H20NOP — CID 6396282
diphenyl-[(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]phosphane (PubChem CID 6396282) has the molecular formula C22H20NOP and a molecular weight of 345.38 g/mol. Its IUPAC name is diphenyl-[(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]phosphane.
| Compound Name | diphenyl-[(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]phosphane |
|---|---|
| PubChem CID | 6396282 |
| Molecular Formula | C22H20NOP |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | diphenyl-[(4-phenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]phosphane |
| SMILES | c1ccc(C2COC(CP(c3ccccc3)c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C22H20NOP/c1-4-10-18(11-5-1)21-16-24-22(23-21)17-25(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,21H,16-17H2 |
| InChIKey | BQPACNSUAVUIGW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|