C17H28N2O — CID 63963788
N,3-dimethyl-N-(2-methylbutan-2-yl)-4-(propylamino)benzamide (PubChem CID 63963788) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N,3-dimethyl-N-(2-methylbutan-2-yl)-4-(propylamino)benzamide.
| Compound Name | N,3-dimethyl-N-(2-methylbutan-2-yl)-4-(propylamino)benzamide |
|---|---|
| PubChem CID | 63963788 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N,3-dimethyl-N-(2-methylbutan-2-yl)-4-(propylamino)benzamide |
| SMILES | CCCNc1ccc(C(=O)N(C)C(C)(C)CC)cc1C |
| InChI | InChI=1S/C17H28N2O/c1-7-11-18-15-10-9-14(12-13(15)3)16(20)19(6)17(4,5)8-2/h9-10,12,18H,7-8,11H2,1-6H3 |
| InChIKey | XKJHMHPEDXGGHZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |