(1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid

C10H14O2 — CID 639640

IUPAC(1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid
SMILESCC1(C)[C@@H]2CCC(C(=O)O)=C[C@@H]21
InChIInChI=1S/C10H14O2/c1-10(2)7-4-3-6(9(11)12)5-8(7)10/h5,7-8H,3-4H2,1-2H3,(H,11,12)/t7-,8+/m1/s1
InChIKeyBKLAIYZBALVMQV-SFYZADRCSA-N
MW166.22 g/mol
LogP2.06
Rot. Bonds1

About (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid

(1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid (PubChem CID 639640) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid.

Molecular Properties

Compound Name(1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid
PubChem CID639640
Molecular FormulaC10H14O2
Molecular Weight166.22 g/mol
Exact Mass166.10
IUPAC Name(1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid
SMILESCC1(C)[C@@H]2CCC(C(=O)O)=C[C@@H]21
InChIInChI=1S/C10H14O2/c1-10(2)7-4-3-6(9(11)12)5-8(7)10/h5,7-8H,3-4H2,1-2H3,(H,11,12)/t7-,8+/m1/s1
InChIKeyBKLAIYZBALVMQV-SFYZADRCSA-N
XLogP2.06
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.22
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid?
The IUPAC name of (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid (CID 639640) is (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid.
What is the SMILES notation for (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid?
The canonical SMILES for (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid is CC1(C)[C@@H]2CCC(C(=O)O)=C[C@@H]21.
What is the InChIKey of (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid?
The InChIKey is BKLAIYZBALVMQV-SFYZADRCSA-N. The full InChI is InChI=1S/C10H14O2/c1-10(2)7-4-3-6(9(11)12)5-8(7)10/h5,7-8H,3-4H2,1-2H3,(H,11,12)/t7-,8+/m1/s1.
What are the key properties of (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid?
(1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid has a molecular weight of 166.22 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6R)-7,7-dimethylbicyclo[4.1.0]hept-2-ene-3-carboxylic acid is sourced from PubChem (CID 639640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).