About 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol
1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol (PubChem CID 63964031) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol |
| PubChem CID | 63964031 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol |
| SMILES | Cc1cc(NCC2(O)CCCC(C)C2)nc(C)n1 |
| InChI | InChI=1S/C14H23N3O/c1-10-5-4-6-14(18,8-10)9-15-13-7-11(2)16-12(3)17-13/h7,10,18H,4-6,8-9H2,1-3H3,(H,15,16,17) |
| InChIKey | SRYXCVVRFYXENR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol?
The IUPAC name of 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol (CID 63964031) is 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol.
What is the SMILES notation for 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol?
The canonical SMILES for 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol is Cc1cc(NCC2(O)CCCC(C)C2)nc(C)n1.
What is the InChIKey of 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol?
The InChIKey is SRYXCVVRFYXENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O/c1-10-5-4-6-14(18,8-10)9-15-13-7-11(2)16-12(3)17-13/h7,10,18H,4-6,8-9H2,1-3H3,(H,15,16,17).
What are the key properties of 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol?
1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol has a molecular weight of 249.36 g/mol, XLogP of 2.45, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2,6-dimethylpyrimidin-4-yl)amino]methyl]-3-methylcyclohexan-1-ol is sourced from PubChem (CID 63964031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).