C11H12F5NS — CID 63967239
2,3,4,5,6-pentafluoro-N-(2-methyl-3-methylsulfanylpropyl)aniline (PubChem CID 63967239) has the molecular formula C11H12F5NS and a molecular weight of 285.28 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(2-methyl-3-methylsulfanylpropyl)aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(2-methyl-3-methylsulfanylpropyl)aniline |
|---|---|
| PubChem CID | 63967239 |
| Molecular Formula | C11H12F5NS |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(2-methyl-3-methylsulfanylpropyl)aniline |
| SMILES | CSCC(C)CNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H12F5NS/c1-5(4-18-2)3-17-11-9(15)7(13)6(12)8(14)10(11)16/h5,17H,3-4H2,1-2H3 |
| InChIKey | LSXYRBVMAYAODG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|