About 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol
3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol (PubChem CID 63967749) has the molecular formula C8H10F3N3O
and a molecular weight of 221.18 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol.
Molecular Properties
| Compound Name | 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol |
| PubChem CID | 63967749 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol |
| SMILES | CC(N)C(O)(c1cnccn1)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N3O/c1-5(12)7(15,8(9,10)11)6-4-13-2-3-14-6/h2-5,15H,12H2,1H3 |
| InChIKey | RLKLQHBSTSQOEA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol?
The IUPAC name of 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol (CID 63967749) is 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol.
What is the SMILES notation for 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol?
The canonical SMILES for 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol is CC(N)C(O)(c1cnccn1)C(F)(F)F.
What is the InChIKey of 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol?
The InChIKey is RLKLQHBSTSQOEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O/c1-5(12)7(15,8(9,10)11)6-4-13-2-3-14-6/h2-5,15H,12H2,1H3.
What are the key properties of 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol?
3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol has a molecular weight of 221.18 g/mol, XLogP of 0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1,1,1-trifluoro-2-pyrazin-2-ylbutan-2-ol is sourced from PubChem (CID 63967749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).