About methyl 2-pyrazin-2-ylpropanoate
methyl 2-pyrazin-2-ylpropanoate (PubChem CID 63968586) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is methyl 2-pyrazin-2-ylpropanoate.
Molecular Properties
| Compound Name | methyl 2-pyrazin-2-ylpropanoate |
| PubChem CID | 63968586 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | methyl 2-pyrazin-2-ylpropanoate |
| SMILES | COC(=O)C(C)c1cnccn1 |
| InChI | InChI=1S/C8H10N2O2/c1-6(8(11)12-2)7-5-9-3-4-10-7/h3-6H,1-2H3 |
| InChIKey | CDDUYOBBAAAKMU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-pyrazin-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-pyrazin-2-ylpropanoate?
The IUPAC name of methyl 2-pyrazin-2-ylpropanoate (CID 63968586) is methyl 2-pyrazin-2-ylpropanoate.
What is the SMILES notation for methyl 2-pyrazin-2-ylpropanoate?
The canonical SMILES for methyl 2-pyrazin-2-ylpropanoate is COC(=O)C(C)c1cnccn1.
What is the InChIKey of methyl 2-pyrazin-2-ylpropanoate?
The InChIKey is CDDUYOBBAAAKMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-6(8(11)12-2)7-5-9-3-4-10-7/h3-6H,1-2H3.
What are the key properties of methyl 2-pyrazin-2-ylpropanoate?
methyl 2-pyrazin-2-ylpropanoate has a molecular weight of 166.18 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-pyrazin-2-ylpropanoate is sourced from PubChem (CID 63968586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).