C10H11N5 — CID 63968599
N-methyl-1,1-di(pyrazin-2-yl)methanamine (PubChem CID 63968599) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is N-methyl-1,1-di(pyrazin-2-yl)methanamine.
| Compound Name | N-methyl-1,1-di(pyrazin-2-yl)methanamine |
|---|---|
| PubChem CID | 63968599 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-methyl-1,1-di(pyrazin-2-yl)methanamine |
| SMILES | CNC(c1cnccn1)c1cnccn1 |
| InChI | InChI=1S/C10H11N5/c1-11-10(8-6-12-2-4-14-8)9-7-13-3-5-15-9/h2-7,10-11H,1H3 |
| InChIKey | SJTPZYXRRPIARC-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |