C36H42N2 — CID 6396925
1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diamine (PubChem CID 6396925) has the molecular formula C36H42N2 and a molecular weight of 502.75 g/mol. Its IUPAC name is 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diamine.
| Compound Name | 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diamine |
|---|---|
| PubChem CID | 6396925 |
| Molecular Formula | C36H42N2 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]acenaphthylene-1,2-diamine |
| SMILES | CC(C)c1cccc(C(C)C)c1NC1=C(Nc2c(C(C)C)cccc2C(C)C)c2cccc3cccc1c23 |
| InChI | InChI=1S/C36H42N2/c1-21(2)26-15-11-16-27(22(3)4)33(26)37-35-30-19-9-13-25-14-10-20-31(32(25)30)36(35)38-34-28(23(5)6)17-12-18-29(34)24(7)8/h9-24,37-38H,1-8H3 |
| InChIKey | RPORGOUVDXWGKY-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |