C12H11FN4O — CID 63971187
N-(4,6-dimethylpyrimidin-2-yl)-6-fluoropyridine-3-carboxamide (PubChem CID 63971187) has the molecular formula C12H11FN4O and a molecular weight of 246.25 g/mol. Its IUPAC name is N-(4,6-dimethylpyrimidin-2-yl)-6-fluoropyridine-3-carboxamide.
| Compound Name | N-(4,6-dimethylpyrimidin-2-yl)-6-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 63971187 |
| Molecular Formula | C12H11FN4O |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-(4,6-dimethylpyrimidin-2-yl)-6-fluoropyridine-3-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)c2ccc(F)nc2)n1 |
| InChI | InChI=1S/C12H11FN4O/c1-7-5-8(2)16-12(15-7)17-11(18)9-3-4-10(13)14-6-9/h3-6H,1-2H3,(H,15,16,17,18) |
| InChIKey | BFRCOFDFFYCKMK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|