C15H12N4S — CID 639716
6,10-dimethyl-12-phenyl-4-thia-2,5,11,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene (PubChem CID 639716) has the molecular formula C15H12N4S and a molecular weight of 280.36 g/mol. Its IUPAC name is 6,10-dimethyl-12-phenyl-4-thia-2,5,11,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene.
| Compound Name | 6,10-dimethyl-12-phenyl-4-thia-2,5,11,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene |
|---|---|
| PubChem CID | 639716 |
| Molecular Formula | C15H12N4S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 6,10-dimethyl-12-phenyl-4-thia-2,5,11,12-tetrazatricyclo[7.3.0.03,7]dodeca-1,3(7),5,8,10-pentaene |
| SMILES | Cc1nsc2nc3c(cc12)c(C)nn3-c1ccccc1 |
| InChI | InChI=1S/C15H12N4S/c1-9-12-8-13-10(2)18-20-15(13)16-14(12)19(17-9)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | FHZZWSNWDWXQFV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |