C18H31N5 — CID 6397464
3-(2,12-dimethyl-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(16),2,10,14-tetraen-7-yl)propan-1-amine (PubChem CID 6397464) has the molecular formula C18H31N5 and a molecular weight of 317.48 g/mol. Its IUPAC name is 3-(2,12-dimethyl-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(16),2,10,14-tetraen-7-yl)propan-1-amine.
| Compound Name | 3-(2,12-dimethyl-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(16),2,10,14-tetraen-7-yl)propan-1-amine |
|---|---|
| PubChem CID | 6397464 |
| Molecular Formula | C18H31N5 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.26 |
| IUPAC Name | 3-(2,12-dimethyl-3,7,11,17-tetrazabicyclo[11.3.1]heptadeca-1(16),2,10,14-tetraen-7-yl)propan-1-amine |
| SMILES | C/C1=N\CCCN(CCCN)CC/C=N/C(C)C2C=CC=C1N2 |
| InChI | InChI=1S/C18H31N5/c1-15-17-7-3-8-18(22-17)16(2)21-11-6-14-23(12-4-9-19)13-5-10-20-15/h3,7-8,10,15,17,22H,4-6,9,11-14,19H2,1-2H3/b20-10+,21-16+ |
| InChIKey | RPZTZYIVBPSQBD-UYFDDYNLSA-N |
| XLogP | 1.76 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |