About (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone
(1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone (PubChem CID 6397529) has the molecular formula C17H22OP+
and a molecular weight of 273.34 g/mol. Its IUPAC name is (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone |
| PubChem CID | 6397529 |
| Molecular Formula | C17H22OP+ |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone |
| SMILES | CC1=C[P+](C(=O)c2ccccc2)(C(C)(C)C)C=C1C |
| InChI | InChI=1S/C17H22OP/c1-13-11-19(12-14(13)2,17(3,4)5)16(18)15-9-7-6-8-10-15/h6-12H,1-5H3/q+1 |
| InChIKey | LJVVFTLABBBRMC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone?
The IUPAC name of (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone (CID 6397529) is (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone.
What is the SMILES notation for (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone?
The canonical SMILES for (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone is CC1=C[P+](C(=O)c2ccccc2)(C(C)(C)C)C=C1C.
What is the InChIKey of (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone?
The InChIKey is LJVVFTLABBBRMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22OP/c1-13-11-19(12-14(13)2,17(3,4)5)16(18)15-9-7-6-8-10-15/h6-12H,1-5H3/q+1.
What are the key properties of (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone?
(1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone has a molecular weight of 273.34 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyl-3,4-dimethylphosphol-1-ium-1-yl)-phenylmethanone is sourced from PubChem (CID 6397529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).