About tetramethyl-germole
tetramethyl-germole (PubChem CID 6397636) has the molecular formula C8H12Ge
and a molecular weight of 180.79 g/mol.
Molecular Properties
| Compound Name | tetramethyl-germole |
| PubChem CID | 6397636 |
| Molecular Formula | C8H12Ge |
| Molecular Weight | 180.79 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)=C(C)[Ge]1 |
| InChI | InChI=1S/C8H12Ge/c1-5-6(2)8(4)9-7(5)3/h1-4H3 |
| InChIKey | WWDWHFXDCIJYNL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetramethyl-germole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetramethyl-germole?
The IUPAC name of tetramethyl-germole (CID 6397636) is not available.
What is the SMILES notation for tetramethyl-germole?
The canonical SMILES for tetramethyl-germole is CC1=C(C)C(C)=C(C)[Ge]1.
What is the InChIKey of tetramethyl-germole?
The InChIKey is WWDWHFXDCIJYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12Ge/c1-5-6(2)8(4)9-7(5)3/h1-4H3.
What are the key properties of tetramethyl-germole?
tetramethyl-germole has a molecular weight of 180.79 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetramethyl-germole is sourced from PubChem (CID 6397636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).