About ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate
ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate (PubChem CID 63976759) has the molecular formula C9H12F2N2O2
and a molecular weight of 218.20 g/mol. Its IUPAC name is ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate |
| PubChem CID | 63976759 |
| Molecular Formula | C9H12F2N2O2 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)c1ccnn1CC |
| InChI | InChI=1S/C9H12F2N2O2/c1-3-13-7(5-6-12-13)9(10,11)8(14)15-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | BMIRMRVOTVWQSW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate?
The IUPAC name of ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate (CID 63976759) is ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate is CCOC(=O)C(F)(F)c1ccnn1CC.
What is the InChIKey of ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate?
The InChIKey is BMIRMRVOTVWQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O2/c1-3-13-7(5-6-12-13)9(10,11)8(14)15-4-2/h5-6H,3-4H2,1-2H3.
What are the key properties of ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate?
ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate has a molecular weight of 218.20 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-ethylpyrazol-3-yl)-2,2-difluoroacetate is sourced from PubChem (CID 63976759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).