About 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide
4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide (PubChem CID 63977675) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide |
| PubChem CID | 63977675 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide |
| SMILES | C/N=C(\N)N1CCC(COC)CC1 |
| InChI | InChI=1S/C9H19N3O/c1-11-9(10)12-5-3-8(4-6-12)7-13-2/h8H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | BWKSSMIOTSMQMS-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide?
The IUPAC name of 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide (CID 63977675) is 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide.
What is the SMILES notation for 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide?
The canonical SMILES for 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide is C/N=C(\N)N1CCC(COC)CC1.
What is the InChIKey of 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide?
The InChIKey is BWKSSMIOTSMQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O/c1-11-9(10)12-5-3-8(4-6-12)7-13-2/h8H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide?
4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide has a molecular weight of 185.27 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methoxymethyl)-N'-methylpiperidine-1-carboximidamide is sourced from PubChem (CID 63977675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).