About 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide
5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide (PubChem CID 63980403) has the molecular formula C13H18N4O2S
and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide |
| PubChem CID | 63980403 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide |
| SMILES | CN(CCc1ccccc1)S(=O)(=O)c1c(N)ncn1C |
| InChI | InChI=1S/C13H18N4O2S/c1-16-10-15-12(14)13(16)20(18,19)17(2)9-8-11-6-4-3-5-7-11/h3-7,10H,8-9,14H2,1-2H3 |
| InChIKey | WMWUMAQXSTWVGQ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide?
The IUPAC name of 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide (CID 63980403) is 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide.
What is the SMILES notation for 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide?
The canonical SMILES for 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide is CN(CCc1ccccc1)S(=O)(=O)c1c(N)ncn1C.
What is the InChIKey of 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide?
The InChIKey is WMWUMAQXSTWVGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2S/c1-16-10-15-12(14)13(16)20(18,19)17(2)9-8-11-6-4-3-5-7-11/h3-7,10H,8-9,14H2,1-2H3.
What are the key properties of 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide?
5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide has a molecular weight of 294.38 g/mol, XLogP of 0.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N,3-dimethyl-N-(2-phenylethyl)imidazole-4-sulfonamide is sourced from PubChem (CID 63980403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).