C14H9FN4O2 — CID 63980510
6-fluoro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 63980510) has the molecular formula C14H9FN4O2 and a molecular weight of 284.25 g/mol. Its IUPAC name is 6-fluoro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-fluoro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63980510 |
| Molecular Formula | C14H9FN4O2 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 6-fluoro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)o1)c1ccc(F)nc1 |
| InChI | InChI=1S/C14H9FN4O2/c15-11-7-6-10(8-16-11)12(20)17-14-19-18-13(21-14)9-4-2-1-3-5-9/h1-8H,(H,17,19,20) |
| InChIKey | XWVZMPVIOFFOKN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|