C10H16N2O2S2 — CID 63981145
2-amino-4-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide (PubChem CID 63981145) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide.
| Compound Name | 2-amino-4-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63981145 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-amino-4-methyl-N-(2-methylsulfanylethyl)benzenesulfonamide |
| SMILES | CSCCNS(=O)(=O)c1ccc(C)cc1N |
| InChI | InChI=1S/C10H16N2O2S2/c1-8-3-4-10(9(11)7-8)16(13,14)12-5-6-15-2/h3-4,7,12H,5-6,11H2,1-2H3 |
| InChIKey | WZAILDAIWULHMD-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|