About 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine
5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine (PubChem CID 63983982) has the molecular formula C10H13N3S2
and a molecular weight of 239.37 g/mol. Its IUPAC name is 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine |
| PubChem CID | 63983982 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine |
| SMILES | CSCCNc1ccc2scnc2c1N |
| InChI | InChI=1S/C10H13N3S2/c1-14-5-4-12-7-2-3-8-10(9(7)11)13-6-15-8/h2-3,6,12H,4-5,11H2,1H3 |
| InChIKey | ITVUFHCEVKDMSB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine?
The IUPAC name of 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine (CID 63983982) is 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine.
What is the SMILES notation for 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine?
The canonical SMILES for 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine is CSCCNc1ccc2scnc2c1N.
What is the InChIKey of 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine?
The InChIKey is ITVUFHCEVKDMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S2/c1-14-5-4-12-7-2-3-8-10(9(7)11)13-6-15-8/h2-3,6,12H,4-5,11H2,1H3.
What are the key properties of 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine?
5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine has a molecular weight of 239.37 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2-methylsulfanylethyl)-1,3-benzothiazole-4,5-diamine is sourced from PubChem (CID 63983982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).