C18H24O3 — CID 6398418
(2R,3S)-butane-1,2,3-triol;(5E,6E)-5-[(2Z)-penta-2,4-dienylidene]-6-prop-2-enylidenecyclohexa-1,3-diene (PubChem CID 6398418) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2R,3S)-butane-1,2,3-triol;(5E,6E)-5-[(2Z)-penta-2,4-dienylidene]-6-prop-2-enylidenecyclohexa-1,3-diene.
| Compound Name | (2R,3S)-butane-1,2,3-triol;(5E,6E)-5-[(2Z)-penta-2,4-dienylidene]-6-prop-2-enylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 6398418 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (2R,3S)-butane-1,2,3-triol;(5E,6E)-5-[(2Z)-penta-2,4-dienylidene]-6-prop-2-enylidenecyclohexa-1,3-diene |
| SMILES | C=C/C=C\C=c1/cccc/c1=C\C=C.C[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H14.C4H10O3/c1-3-5-6-10-14-12-8-7-11-13(14)9-4-2;1-3(6)4(7)2-5/h3-12H,1-2H2;3-7H,2H2,1H3/b6-5-,13-9+,14-10+;/t;3-,4+/m.0/s1 |
| InChIKey | NSFTVEZPFPPHOI-OANHJYGYSA-N |
| XLogP | 0.90 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|