About 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid
2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid (PubChem CID 63985848) has the molecular formula C9H11N3O2S
and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid |
| PubChem CID | 63985848 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid |
| SMILES | O=C(O)C1CCSC(c2ccncn2)N1 |
| InChI | InChI=1S/C9H11N3O2S/c13-9(14)7-2-4-15-8(12-7)6-1-3-10-5-11-6/h1,3,5,7-8,12H,2,4H2,(H,13,14) |
| InChIKey | JRKABALHMDRODY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid?
The IUPAC name of 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid (CID 63985848) is 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid.
What is the SMILES notation for 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid?
The canonical SMILES for 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid is O=C(O)C1CCSC(c2ccncn2)N1.
What is the InChIKey of 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid?
The InChIKey is JRKABALHMDRODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2S/c13-9(14)7-2-4-15-8(12-7)6-1-3-10-5-11-6/h1,3,5,7-8,12H,2,4H2,(H,13,14).
What are the key properties of 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid?
2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid has a molecular weight of 225.27 g/mol, XLogP of 0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-4-yl-1,3-thiazinane-4-carboxylic acid is sourced from PubChem (CID 63985848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).