C14H20O3 — CID 63986983
1-[3-(methoxymethyl)phenoxy]-3,3-dimethylbutan-2-one (PubChem CID 63986983) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)phenoxy]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[3-(methoxymethyl)phenoxy]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 63986983 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-[3-(methoxymethyl)phenoxy]-3,3-dimethylbutan-2-one |
| SMILES | COCc1cccc(OCC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H20O3/c1-14(2,3)13(15)10-17-12-7-5-6-11(8-12)9-16-4/h5-8H,9-10H2,1-4H3 |
| InChIKey | GCNBVKHRKXINGX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |