C12H19NO — CID 63988709
1-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]propan-2-amine (PubChem CID 63988709) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]propan-2-amine.
| Compound Name | 1-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 63988709 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-cyclopropyl-N-[(5-methylfuran-2-yl)methyl]propan-2-amine |
| SMILES | Cc1ccc(CNC(C)CC2CC2)o1 |
| InChI | InChI=1S/C12H19NO/c1-9(7-11-4-5-11)13-8-12-6-3-10(2)14-12/h3,6,9,11,13H,4-5,7-8H2,1-2H3 |
| InChIKey | GNFPCCLAOAGCBB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |